O=C(CSC1=NC=NN1)N[C@@H]1C[C@@H]2CC[C@@H]1C2

InChIKey=YGXUPRGOZCRIBN-IWSPIJDZSA-N

C11H16N4OS

252.34

Organic compounds

Lipids and lipid-like molecules

Prenol lipids

Monoterpenoids

Not available

Bicyclic monoterpenoids

Aromatic monoterpenoids Alkylarylthioethers Triazoles Heteroaromatic compounds Secondary carboxylic acid amides Sulfenyl compounds Azacyclic compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic heteropolycyclic compounds

Aromatic monoterpenoid - Bicyclic monoterpenoid - Aryl thioether - Alkylarylthioether - Azole - Heteroaromatic compound - 1,2,4-triazole - Carboxamide group - Secondary carboxylic acid amide - Carboxylic acid derivative - Azacycle - Thioether - Organoheterocyclic compound - Sulfenyl compound - Organooxygen compound - Organonitrogen compound - Hydrocarbon derivative - Organosulfur compound - Organic nitrogen compound - Organic oxygen compound - Organic oxide - Carbonyl group - Aromatic heteropolycyclic compound

This compound belongs to the class of organic compounds known as bicyclic monoterpenoids. These are monoterpenoids containing exactly 2 rings, which are fused to each other.

Not available