C[C@@H]1CC[C@H]2C(C)(C)C[C@]3(C)CC[C@@H](OC(=O)C(F)(F)F)C123

InChIKey=KMUKQBZVFNTLBW-YVCYQBIISA-N

C17H25F3O2

318.38

Organic compounds

Lipids and lipid-like molecules

Prenol lipids

Sesquiterpenoids

Triquinane sesquiterpenoids

Angular triquinanes

Alpha-halocarboxylic acid derivatives Carboxylic acid esters Monocarboxylic acids and derivatives Organofluorides Organic oxides Hydrocarbon derivatives Carbonyl compounds Alkyl fluorides

Aliphatic homopolycyclic compounds

Angular triquinane sesquiterpenoid - Alpha-halocarboxylic acid derivative - Alpha-halocarboxylic acid or derivatives - Carboxylic acid ester - Monocarboxylic acid or derivatives - Carboxylic acid derivative - Organic oxygen compound - Organooxygen compound - Organofluoride - Organohalogen compound - Carbonyl group - Alkyl fluoride - Alkyl halide - Hydrocarbon derivative - Organic oxide - Aliphatic homopolycyclic compound

This compound belongs to the class of organic compounds known as angular triquinanes. These are triquinane with a structure based on a [6.3.0.0^1,5] undecane carbon skeleton.

Not available