Chemical category
Organic pyrophosphates
Description
Organic compounds containing the pyrophosphate oxoanion, with the structure OP([O-])(=O)OP(O)([O-])=O.
Ancestors
Below are a few examples of organic pyrophosphates found in the ClassyFire database.
Example Entities
| ID | Structure | Formula | Mass | |
|---|---|---|---|---|
| 5003 |  |
C9H18O7P2 | 300.184 | Show |
| 86328 |  |
C39H68N7O17P3S | 1031.99 | Show |
| 154483 |  |
C39H66N7O17P3S | 1029.97 | Show |
| 172043 |  |
C30H42N7O19P3S | 929.68 | Show |
| 174501 |  |
C20H36O7P2 | 450.449 | Show |
| 177297 |  |
C10H19FO7P2 | 332.201 | Show |
| 310765 |  |
C8H12O7P2 | 282.125 | Show |
| 314763 |  |
C28H24N4O15P2 | 718.461 | Show |
| 329054 |  |
C35H60N7O17P3S | 975.88 | Show |
| 339502 |  |
C14H26O7P2 | 368.303 | Show |
| 337389 |  |
C48H89N5O12P2S | 1022.27 | Show |
| 337537 |  |
C46H85N5O12P2S | 994.22 | Show |
| 397965 |  |
C15H30O7P2 | 384.346 | Show |
| 400077 |  |
C15H28O7P2 | 382.33 | Show |
| 405233 |  |
C37H64N7O17P3S | 1003.93 | Show |
| 405394 |  |
C29H48N7O17P3S | 891.72 | Show |
| 400812 |  |
C20H36O7P2 | 450.449 | Show |
| 400819 |  |
C20H36O7P2 | 450.449 | Show |
| 408710 |  |
C45H81N5O14P2 | 978.112 | Show |
| 421004 |  |
C24H41N5O11P2 | 637.564 | Show |
| 421046 |  |
C23H39N5O12P2 | 639.536 | Show |
| 422662 |  |
C47H87N5O12P2S | 1008.24 | Show |
| 422760 |  |
C46H83N5Na2O12P2S | 1038.18 | Show |
| 422835 |  |
C43H79N5O13P2 | 936.075 | Show |
| 423926 |  |
C49H89N5O14P2 | 1034.22 | Show |