O=C(CCNC(=O)C1=CC=CO1)NC[C@@H]1CCCO1

InChIKey=ZXLKDNZDMOPCHZ-JTQLQIEISA-N

C13H18N2O4

266.297

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Amino acids, peptides, and analogues

Amino acids and derivatives

Beta amino acids and derivatives

Furoic acid and derivatives 2-heteroaryl carboxamides Oxolanes Heteroaromatic compounds Secondary carboxylic acid amides Oxacyclic compounds Dialkyl ethers Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic heteromonocyclic compounds

Beta amino acid or derivatives - 2-heteroaryl carboxamide - Furoic acid or derivatives - Furan - Oxolane - Heteroaromatic compound - Carboxamide group - Secondary carboxylic acid amide - Dialkyl ether - Ether - Oxacycle - Organoheterocyclic compound - Organonitrogen compound - Organic oxide - Organic nitrogen compound - Organooxygen compound - Hydrocarbon derivative - Carbonyl group - Organic oxygen compound - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as beta amino acids and derivatives. These are amino acids having a (-NH2) group attached to the beta carbon atom.

Not available