OC(=O)C1=CC=CC=C1NC1=CC=CC=C1

InChIKey=ZWJINEZUASEZBH-UHFFFAOYSA-N

C13H11NO2

213.236

Organic compounds

Benzenoids

Benzene and substituted derivatives

Benzoic acids and derivatives

Aminobenzoic acids and derivatives

Aminobenzoic acids

Benzoic acids Benzoyl derivatives Aniline and substituted anilines Vinylogous amides Amino acids Secondary amines Monocarboxylic acids and derivatives Carboxylic acids Organopnictogen compounds Organooxygen compounds Organic oxides Hydrocarbon derivatives

Aromatic homomonocyclic compounds

Aminobenzoic acid - Benzoic acid - Benzoyl - Aniline or substituted anilines - Vinylogous amide - Amino acid or derivatives - Amino acid - Secondary amine - Monocarboxylic acid or derivatives - Carboxylic acid - Carboxylic acid derivative - Organic oxide - Organooxygen compound - Organonitrogen compound - Organopnictogen compound - Organic oxygen compound - Organic nitrogen compound - Amine - Hydrocarbon derivative - Aromatic homomonocyclic compound

This compound belongs to the class of organic compounds known as aminobenzoic acids. These are benzoic acids containing an amine group attached to the benzene moiety.

CHEBI:34756 : secondary amino compound - aminobenzoic acid