CS(=O)C1=CC=C(C=C1)C(=O)NC1=CC=C(C=C1)C(=O)N1CCC2(CCCC=C2)CC2=CC=CC=C12

InChIKey=ZRJYUYCGVMDHOG-UHFFFAOYSA-N

C30H30N2O3S

498.64

Organic compounds

Benzenoids

Benzene and substituted derivatives

Anilides

Aromatic anilides

Benzanilides

Benzazepines P-sulfanylbenzoic acids and derivatives Benzamides Phenyl sulfoxides Benzoyl derivatives Azepines Tertiary carboxylic acid amides Sulfoxides Secondary carboxylic acid amides Azacyclic compounds Sulfinyl compounds Organic oxides Hydrocarbon derivatives Organopnictogen compounds Organonitrogen compounds Organooxygen compounds

Aromatic heteropolycyclic compounds

Benzanilide - Benzazepine - P-sulfanylbenzoic acid or derivatives - Phenyl sulfoxide - Benzamide - Benzoic acid or derivatives - Benzoyl - Azepine - Tertiary carboxylic acid amide - Carboxamide group - Secondary carboxylic acid amide - Sulfoxide - Azacycle - Carboxylic acid derivative - Organoheterocyclic compound - Sulfinyl compound - Organic nitrogen compound - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Organic oxygen compound - Aromatic heteropolycyclic compound

This compound belongs to the class of organic compounds known as benzanilides. These are aromatic compounds containing an anilide group in which the carboxamide group is substituted with a benzene ring. They have the general structure RNC(=O)R', where R,R'= benzene.

Not available