O=C1CCCCCCCC(=O)N1CC1=CC=CS1

InChIKey=ZHHYTKOJVPVTIL-UHFFFAOYSA-N

C14H19NO2S

265.37

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Carboxylic acid derivatives

Carboxylic acid imides

N-substituted carboxylic acid imides

Thiophenes Heteroaromatic compounds Dicarboximides Lactams Azacyclic compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic heteromonocyclic compounds

Carboxylic acid imide, n-substituted - Heteroaromatic compound - Thiophene - Dicarboximide - Lactam - Azacycle - Organoheterocyclic compound - Organic nitrogen compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Carbonyl group - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as n-substituted carboxylic acid imides. These are compounds comprising an N-substituted carboxylic acid imide group, with the general structure R1N(C(R2)=O)C(R3)=O (R2,R3=H, alkyl, aryl; R1=Anything but H).

Not available