CCOC(=O)C1CC2=CC(C)=NC=C2C1=O

InChIKey=ZFKCLYRGGDRTAW-UHFFFAOYSA-N

C12H13NO3

219.24

Organic compounds

Organic oxygen compounds

Organooxygen compounds

Carbonyl compounds

Ketones - Aryl ketones

Aryl alkyl ketones

Methylpyridines 1,3-dicarbonyl compounds Heteroaromatic compounds Carboxylic acid esters Monocarboxylic acids and derivatives Azacyclic compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives

Aromatic heteropolycyclic compounds

Aryl alkyl ketone - Methylpyridine - 1,3-dicarbonyl compound - Pyridine - Heteroaromatic compound - Carboxylic acid ester - Azacycle - Organoheterocyclic compound - Monocarboxylic acid or derivatives - Carboxylic acid derivative - Organic nitrogen compound - Organic oxide - Hydrocarbon derivative - Organonitrogen compound - Aromatic heteropolycyclic compound

This compound belongs to the class of organic compounds known as aryl alkyl ketones. These are ketones have the generic structure RC(=O)R', where R = aryl group and R'=alkyl group.

Not available