C[C@H](NC(=O)C1=CC=CC=C1S)C(N)=O

InChIKey=ZBASXCRSAAVKFK-LURJTMIESA-N

C10H12N2O2S

224.28

Organic compounds

Benzenoids

Benzene and substituted derivatives

Benzoic acids and derivatives

Benzamides

Hippuric acids and derivatives

N-acyl-alpha amino acids and derivatives Alanine and derivatives O-sulfanylbenzoic acids and derivatives Thiophenols Benzoyl derivatives Secondary carboxylic acid amides Primary carboxylic acid amides Thiols Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic homomonocyclic compounds

Hippuric acid or derivatives - N-acyl-alpha amino acid or derivatives - Alanine or derivatives - N-substituted-alpha-amino acid - Alpha-amino acid or derivatives - O-sulfanylbenzoic acid or derivatives - Benzoyl - Thiophenol - Carboxamide group - Primary carboxylic acid amide - Secondary carboxylic acid amide - Arylthiol - Carboxylic acid derivative - Organooxygen compound - Organonitrogen compound - Hydrocarbon derivative - Organic oxide - Organic nitrogen compound - Carbonyl group - Organopnictogen compound - Organosulfur compound - Organic oxygen compound - Aromatic homomonocyclic compound

This compound belongs to the class of organic compounds known as hippuric acids and derivatives. These are compounds containing a hippuric acid or a derivative, with a structure characterized the presence of a benzoyl group linked to the N-terminal of a glycine.

Not available