OCOCOCCCC1=C(C(O)=O)C(CCCOCOCO)=C(C=C1)C(O)=O

InChIKey=YYZJKBCHVFBYHQ-UHFFFAOYSA-N

C18H26O10

402.396

Organic compounds

Benzenoids

Benzene and substituted derivatives

Benzoic acids and derivatives

Phthalic acid and derivatives

M-phthalic acid and derivatives

Benzoic acids Benzoyl derivatives Dicarboxylic acids and derivatives Hemiacetals Carboxylic acids Acetals Organic oxides Hydrocarbon derivatives

Aromatic homomonocyclic compounds

Meta_phthalic_acid - Benzoic acid - Benzoyl - Dicarboxylic acid or derivatives - Hemiacetal - Carboxylic acid - Carboxylic acid derivative - Acetal - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Aromatic homomonocyclic compound

This compound belongs to the class of organic compounds known as m-phthalic acid and derivatives. These are aromatic compounds containing a benzene ring bearing a carboxylic acid group at ring carbon atoms 1 and 2.

Not available