FC(F)C(F)(F)COC(=O)[C@H]1CC=CC[C@H]1C(=O)NC1CC1

InChIKey=YSAFKEYBEDCBKO-ZJUUUORDSA-N

C14H17F4NO3

323.288

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Carboxylic acid derivatives

Carboxylic acid amides

Secondary carboxylic acid amides

Carboxylic acid esters Monocarboxylic acids and derivatives Organopnictogen compounds Organonitrogen compounds Organofluorides Organic oxides Hydrocarbon derivatives Carbonyl compounds Alkyl fluorides

Aliphatic homomonocyclic compounds

Carboxylic acid ester - Secondary carboxylic acid amide - Monocarboxylic acid or derivatives - Alkyl fluoride - Organic oxide - Hydrocarbon derivative - Organopnictogen compound - Organooxygen compound - Organonitrogen compound - Organofluoride - Organohalogen compound - Organic oxygen compound - Organic nitrogen compound - Carbonyl group - Alkyl halide - Aliphatic homomonocyclic compound

This compound belongs to the class of organic compounds known as secondary carboxylic acid amides. These are compounds containing a secondary carboxylic acid amide functional group, with the general structure RC(=O)N(R')H (R,R'=alkyl, aryl).

Not available