CCOC(=O)N1CCN(CC1)C(=O)CCSCCC1=CC=NC=C1

InChIKey=YPTNARLRNXLAEH-UHFFFAOYSA-N

C17H25N3O3S

351.47

Organic compounds

Organoheterocyclic compounds

Diazinanes

Piperazines

Piperazine carboxylic acids and derivatives

Piperazine carboxylic acids

Pyridines and derivatives Tertiary carboxylic acid amides Heteroaromatic compounds Carbamate esters Sulfenyl compounds Dialkylthioethers Azacyclic compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic heteromonocyclic compounds

Piperazine-1-carboxylic acid - Pyridine - Tertiary carboxylic acid amide - Heteroaromatic compound - Carbamic acid ester - Carboxamide group - Carboxylic acid derivative - Thioether - Azacycle - Sulfenyl compound - Dialkylthioether - Organic oxide - Organic oxygen compound - Organosulfur compound - Organooxygen compound - Hydrocarbon derivative - Carbonyl group - Organic nitrogen compound - Organonitrogen compound - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as piperazine carboxylic acids. These are heterocyclic compounds containing a piperazine ring substituted by one or more carboxylic acid groups.

Not available