CCCOC(=O)OCCCOP(=O)(OCCCOC(=O)OCCC)N=C(N)N(C)C(CCC)C(O)=O

InChIKey=XZEKCIQUORKQMF-UHFFFAOYSA-N

C21H40N3O11P

541.535

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Amino acids, peptides, and analogues

Amino acids and derivatives

Alpha amino acids and derivatives

Phosphate esters Fatty acids and conjugates Carbonic acid diesters Guanidines Monocarboxylic acids and derivatives Carboxylic acids Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aliphatic acyclic compounds

Alpha-amino acid or derivatives - Carbonic acid diester - Organic phosphoric acid derivative - Phosphoric acid ester - Fatty acid - Carbonic acid derivative - Guanidine - Monocarboxylic acid or derivatives - Carboxylic acid - Organooxygen compound - Organonitrogen compound - Organic nitrogen compound - Carbonyl group - Hydrocarbon derivative - Organic oxide - Organic oxygen compound - Aliphatic acyclic compound

This compound belongs to the class of organic compounds known as alpha amino acids and derivatives. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon), or a derivative thereof.

Not available