CCOC(=O)C1=CC(SC(=O)N(C)C)=C(C=C1SC(=O)N(C)C)C(=O)OCC

InChIKey=XYTFSAKDCYCQRJ-UHFFFAOYSA-N

C18H24N2O6S2

428.52

Organic compounds

Benzenoids

Benzene and substituted derivatives

Benzoic acids and derivatives

Phthalic acid and derivatives - Phthalate esters

p-Phthalate esters

P-phthalic acid and derivatives Benzoic acid esters M-sulfanylbenzoic acids and derivatives O-sulfanylbenzoic acids and derivatives Aryl thioethers Benzoyl derivatives Dicarboxylic acids and derivatives Thiocarbamic acid derivatives Carboxylic acid esters Organic carbonic acids and derivatives Sulfenyl compounds Organonitrogen compounds Carbonyl compounds Hydrocarbon derivatives Organic oxides Organopnictogen compounds

Aromatic homomonocyclic compounds

Para-phthalic acid ester - Para_phthalic_acid - Benzoate ester - M-sulfanylbenzoic acid or derivatives - O-sulfanylbenzoic acid or derivatives - Aryl thioether - Benzoyl - Dicarboxylic acid or derivatives - Carboxylic acid ester - Carbonic acid derivative - Thiocarbamic acid derivative - Carboxylic acid derivative - Sulfenyl compound - Organooxygen compound - Organonitrogen compound - Organic nitrogen compound - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Carbonyl group - Organosulfur compound - Organic oxygen compound - Aromatic homomonocyclic compound

This compound belongs to the class of organic compounds known as p-phthalate esters. These are ester derivatives of p-phthalic acids, which are based on a benzene 1,4-dicarboxylic acid skeleton.

Not available