CC(=O)NC(=CC1=CC=CC=C1)C(=O)N1CCCC1C(O)=O

InChIKey=XTBSKDXUPYJHPU-UHFFFAOYSA-N

C16H18N2O4

302.33

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Amino acids, peptides, and analogues

Not available

Peptides

Proline and derivatives N-acyl-alpha amino acids Alpha amino acid amides Cinnamic acids and derivatives Pyrrolidine carboxylic acids N-acylpyrrolidines Benzene and substituted derivatives Tertiary carboxylic acid amides Acetamides Secondary carboxylic acid amides Monocarboxylic acids and derivatives Azacyclic compounds Carboxylic acids Carbonyl compounds Hydrocarbon derivatives Organic oxides Organonitrogen compounds

Aromatic heteromonocyclic compounds

Alpha peptide - N-acyl-alpha-amino acid - N-acyl-alpha amino acid or derivatives - Proline or derivatives - Alpha-amino acid amide - Cinnamic acid or derivatives - Alpha-amino acid or derivatives - N-acylpyrrolidine - Pyrrolidine carboxylic acid - Pyrrolidine carboxylic acid or derivatives - Benzenoid - Monocyclic benzene moiety - Pyrrolidine - Tertiary carboxylic acid amide - Acetamide - Secondary carboxylic acid amide - Carboxamide group - Organoheterocyclic compound - Azacycle - Carboxylic acid - Monocarboxylic acid or derivatives - Organic oxide - Organic nitrogen compound - Organic oxygen compound - Hydrocarbon derivative - Carbonyl group - Organonitrogen compound - Organooxygen compound - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as peptides. These are compounds containing an amide derived from two or more amino carboxylic acid molecules (the same or different) by formation of a covalent bond from the carbonyl carbon of one to the nitrogen atom of another.

Not available