CC(=C)COP(O)(=O)N1CCCCCC1

InChIKey=XQZBLQFWBWOMHP-UHFFFAOYSA-N

C10H20NO3P

233.248

Organic compounds

Organic acids and derivatives

Organic phosphoric acids and derivatives

Organic phosphoramides

Organic phosphoric acid monoamides

Phosphoric monoester monoamides

Azepanes Phosphate esters Azacyclic compounds Organooxygen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives

Aliphatic heteromonocyclic compounds

Phosphoric monoester monoamide - Azepane - Phosphoric acid ester - Azacycle - Organoheterocyclic compound - Organic nitrogen compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Aliphatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as phosphoric monoester monoamides. These are organophosphorus compounds containing a monoamide derivative of a phosphoric acid monoester functional group. They have the general structure R1OP(=O)(OH)N(R3)R4, where R1 = organyl group and R3-R4 = H or organyl.

Not available