CC(C)C(NC(=O)OC(C)(C)C)C(=O)C1=NN=C(O1)C(C)(C)C

InChIKey=XQVLIHLQUPIJJK-UHFFFAOYSA-N

C16H27N3O4

325.409

Organic compounds

Organic oxygen compounds

Organooxygen compounds

Carbonyl compounds

Ketones - Aryl ketones

Aryl alkyl ketones

Heteroaromatic compounds Carbamate esters 1,3,4-oxadiazoles Oxacyclic compounds Azacyclic compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives

Aromatic heteromonocyclic compounds

Aryl alkyl ketone - Heteroaromatic compound - Carbamic acid ester - Oxadiazole - Azole - 1,3,4-oxadiazole - Oxacycle - Azacycle - Organoheterocyclic compound - Organic nitrogen compound - Organic oxide - Hydrocarbon derivative - Organonitrogen compound - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as aryl alkyl ketones. These are ketones have the generic structure RC(=O)R', where R = aryl group and R'=alkyl group.

Not available