OC(=O)CN(CCCCN(CC(O)=O)N=O)N=O

InChIKey=XCFYPWQDKOXJLX-UHFFFAOYSA-N

C8H14N4O6

262.222

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Amino acids, peptides, and analogues

Amino acids and derivatives

Alpha amino acids and derivatives

Dicarboxylic acids and derivatives Organic N-nitroso compounds Carboxylic acids Organopnictogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aliphatic acyclic compounds

Alpha-amino acid or derivatives - Dicarboxylic acid or derivatives - Organic n-nitroso compound - Organic nitroso compound - Carboxylic acid - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Carbonyl group - Aliphatic acyclic compound

This compound belongs to the class of organic compounds known as alpha amino acids and derivatives. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon), or a derivative thereof.

Not available