CC(CC(NP(O)(=O)CC1=CC=CC=C1)C(O)=O)C1=CC=CC=C1

InChIKey=XBTDKVNUSLDEDI-UHFFFAOYSA-N

C18H22NO4P

347.351

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Amino acids, peptides, and analogues

Amino acids and derivatives

Alpha amino acids and derivatives

Benzene and substituted derivatives Organic phosphonic acids Monocarboxylic acids and derivatives Carboxylic acids Organophosphorus compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic homomonocyclic compounds

Alpha-amino acid or derivatives - Monocyclic benzene moiety - Benzenoid - Organophosphonic acid - Organophosphonic acid derivative - Carboxylic acid - Monocarboxylic acid or derivatives - Organic nitrogen compound - Organonitrogen compound - Organooxygen compound - Organophosphorus compound - Hydrocarbon derivative - Organic oxide - Carbonyl group - Organic oxygen compound - Aromatic homomonocyclic compound

This compound belongs to the class of organic compounds known as alpha amino acids and derivatives. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon), or a derivative thereof.

Not available