CCOP(=S)(OCC)Sc1nc(C)cc(C)n1

InChIKey=XAXZWQJVIDHWCT-UHFFFAOYSA-N

C10H17N2O2PS2

292.35

Organic compounds

Organoheterocyclic compounds

Diazines

Pyrimidines and pyrimidine derivatives

Not available

Pyrimidines and pyrimidine derivatives

Dithiophosphate S-esters Dithiophosphate O-esters Heteroaromatic compounds Sulfenyl compounds Organothiophosphorus compounds Azacyclic compounds Organopnictogen compounds Organooxygen compounds Organonitrogen compounds Hydrocarbon derivatives

Aromatic heteromonocyclic compounds

Pyrimidine - Dithiophosphate s-ester - Dithiophosphate o-ester - Heteroaromatic compound - Organic dithiophosphate - Azacycle - Sulfenyl compound - Organothiophosphorus compound - Organooxygen compound - Hydrocarbon derivative - Organonitrogen compound - Organosulfur compound - Organopnictogen compound - Organic oxygen compound - Organic nitrogen compound - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as pyrimidines and pyrimidine derivatives. These are compounds containing a pyrimidne ring, which is a six-member aromatic heterocycle which consists of two nitrogen atoms (at positions 1 and 3) and four carbon atoms.

Not available