CCC1=C(CC2=C(Br)C(Br)=C(CC3=C(CC)C(C)=C(N3)C(O)=O)N2)NC(C(O)=O)=C1C

InChIKey=WZNIVUPNKFKHSL-UHFFFAOYSA-N

C22H25Br2N3O4

555.267

Organic compounds

Organoheterocyclic compounds

Pyrroles

Pyrrole carboxylic acids and derivatives

Pyrrole carboxylic acids

Pyrrole 2-carboxylic acids

Substituted pyrroles Aryl bromides Heteroaromatic compounds Carboxylic acids Azacyclic compounds Organooxygen compounds Organonitrogen compounds Organobromides Organic oxides Hydrocarbon derivatives

Aromatic heteromonocyclic compounds

Pyrrole-2-carboxylic acid - Aryl bromide - Aryl halide - Substituted pyrrole - Heteroaromatic compound - Carboxylic acid derivative - Carboxylic acid - Azacycle - Organooxygen compound - Organonitrogen compound - Organobromide - Organohalogen compound - Organic nitrogen compound - Organic oxide - Hydrocarbon derivative - Organic oxygen compound - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as pyrrole 2-carboxylic acids. These are pyrrole carboxylic acids where the carboxyl group is attached at position C2.

Not available