CCOC(=O)C1=NN(C(NC(C)=O)C(C1)NC(=O)OC(C)(C)C)S(=O)(=O)C(CC)CC

InChIKey=WXGXFONPRLOBGW-UHFFFAOYSA-N

C19H34N4O7S

462.56

Organic compounds

Organic nitrogen compounds

Organonitrogen compounds

Hydrazines and derivatives

Hydrazones

N-alkyl sulfonyl hydrazones

Pyridazines and derivatives Sulfonyls Organosulfonic acids and derivatives Carbamate esters Acetamides Secondary carboxylic acid amides N-alkylated hydrazones Carboxylic acid esters Monocarboxylic acids and derivatives Azacyclic compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aliphatic heteromonocyclic compounds

N-alkyl sulfonyl hydrazone - Pyridazine - Acetamide - Organic sulfonic acid or derivatives - Carbamic acid ester - Sulfonyl - Organosulfonic acid or derivatives - Carboxamide group - Carboxylic acid ester - Secondary carboxylic acid amide - N-alkylated hydrazone - Carboxylic acid derivative - Monocarboxylic acid or derivatives - Azacycle - Organoheterocyclic compound - Organooxygen compound - Carbonyl group - Organic oxide - Organosulfur compound - Hydrocarbon derivative - Organic oxygen compound - Aliphatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as n-alkyl sulfonyl hydrazones. These are organonitrogen compounds containing a hydrazone derivative with the generic structure R1C(R2)=NN(R4)S(R3)(=O)=O where R4 = alkyl group and R1-R3 = H or organyl group.

Not available