CC(C)C(N(CNC(=O)C=C)C(=O)CCl)=C(C)C

InChIKey=WWLKQKQGJCNWNH-UHFFFAOYSA-N

C13H21ClN2O2

272.77

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Carboxylic acid derivatives

Carboxylic acid amides

Tertiary carboxylic acid amides

Chloroacetamides Acrylic acids and derivatives Secondary carboxylic acid amides Organonitrogen compounds Organochlorides Organic oxides Hydrocarbon derivatives Carbonyl compounds Alkyl chlorides

Aliphatic acyclic compounds

Tertiary carboxylic acid amide - Acrylic acid or derivatives - Chloroacetamide - Secondary carboxylic acid amide - Organic oxide - Hydrocarbon derivative - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Organochloride - Organohalogen compound - Carbonyl group - Alkyl halide - Alkyl chloride - Organic oxygen compound - Aliphatic acyclic compound

This compound belongs to the class of organic compounds known as tertiary carboxylic acid amides. These are compounds containing an amide derivative of carboxylic acid, with the general structure RN(R1)C(R2)=O (R1-R2 any atom but H).

Not available