[O-]C(=O)[C@@H]1CCCC[C@H]1C(=O)NC1CCCCCCC1

InChIKey=WWGAHHKLEGAQCW-ZIAGYGMSSA-M

C16H26NO3

280.389

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Carboxylic acid derivatives

Carboxylic acid amides

Secondary carboxylic acid amides

Carboxylic acid salts Monocarboxylic acids and derivatives Carboxylic acids Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds Organic anions

Aliphatic homomonocyclic compounds

Secondary carboxylic acid amide - Carboxylic acid salt - Monocarboxylic acid or derivatives - Carboxylic acid - Organic nitrogen compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Carbonyl group - Organic anion - Aliphatic homomonocyclic compound

This compound belongs to the class of organic compounds known as secondary carboxylic acid amides. These are compounds containing a secondary carboxylic acid amide functional group, with the general structure RC(=O)N(R')H (R,R'=alkyl, aryl).

Not available