COCN1C=CN=C1C(=O)C1=CC=CO1

InChIKey=WVFYFZPCJFRZPY-UHFFFAOYSA-N

C10H10N2O3

206.201

Organic compounds

Organic oxygen compounds

Organooxygen compounds

Carbonyl compounds

Ketones

Aryl ketones

N-substituted imidazoles Heteroaromatic compounds Furans Oxacyclic compounds Azacyclic compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives

Aromatic heteromonocyclic compounds

Aryl ketone - N-substituted imidazole - Heteroaromatic compound - Imidazole - Furan - Azole - Oxacycle - Azacycle - Organoheterocyclic compound - Organic nitrogen compound - Organic oxide - Hydrocarbon derivative - Organonitrogen compound - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as aryl ketones. These are organic aromatic compounds that contain a ketone group substituted at one C-atom with an aryl group. They have the generic structure RC(=O)R', where R = aryl group and R'=organyl group.

Not available