CCOC(=O)C1=C(C)C(C(=O)OCC)=C(N1C)C(O)=O

InChIKey=WNFIYVGMYNHTAP-UHFFFAOYSA-N

C13H17NO6

283.28

Organic compounds

Organoheterocyclic compounds

Pyrroles

Pyrrole carboxylic acids and derivatives

Pyrrole carboxylic acids

Pyrrole 2-carboxylic acids

N-methylpyrroles Vinylogous amides Heteroaromatic compounds Carboxylic acid esters Carboxylic acids Azacyclic compounds Organooxygen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives

Aromatic heteromonocyclic compounds

Pyrrole-2-carboxylic acid - N-methylpyrrole - Substituted pyrrole - Heteroaromatic compound - Vinylogous amide - Carboxylic acid ester - Azacycle - Carboxylic acid derivative - Carboxylic acid - Hydrocarbon derivative - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Organic oxide - Organic oxygen compound - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as pyrrole 2-carboxylic acids. These are pyrrole carboxylic acids where the carboxyl group is attached at position C2.

Not available