CN(CCOS(C)(=O)=O)P1(=O)OCCC(ONC(N)=O)N1CCCl

InChIKey=WHNDFLVQFYLJAK-UHFFFAOYSA-N

C10H22ClN4O7PS

408.79

Organic compounds

Organic acids and derivatives

Organic phosphoric acids and derivatives

Organic phosphoramides

Organic phosphoric acid diamides

Phosphoric monoester diamides

Sulfonic acid esters Oxazaphosphinanes Organosulfonic acid esters Sulfonyls Methanesulfonates Oxacyclic compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organochlorides Organic oxides Hydrocarbon derivatives Carbonyl compounds Alkyl chlorides

Aliphatic heteromonocyclic compounds

Phosphoric monoester diamide - Oxazaphosphinane - Sulfonic acid ester - Organosulfonic acid ester - Methanesulfonate - Organic sulfonic acid or derivatives - Organosulfonic acid or derivatives - Sulfonyl - Oxacycle - Azacycle - Organoheterocyclic compound - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Organic oxygen compound - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Organochloride - Organohalogen compound - Organic nitrogen compound - Carbonyl group - Alkyl chloride - Alkyl halide - Aliphatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as phosphoric monoester diamides. These are organophosphorus compounds containing a monoamide derivative of a phosphoric acid diester functional group. They have the general structure R1OP(=O)(N(R2)R3)N(R4)R5, where R1 = organyl group and R2-R5 = H or organyl.

Not available