CCOC(=O)C1=C(C)N=C(SSC2=NC(C)=C(S2)C(=O)OCC)S1

InChIKey=WCFZLLPLAJBZPM-UHFFFAOYSA-N

C14H16N2O4S4

404.53

Organic compounds

Organoheterocyclic compounds

Azoles

Thiazoles

Not available

Thiazolecarboxylic acids and derivatives

2,4,5-trisubstituted thiazoles Dicarboxylic acids and derivatives Heteroaromatic compounds Organic disulfides Carboxylic acid esters Sulfenyl compounds Azacyclic compounds Organopnictogen compounds Organooxygen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives

Aromatic heteromonocyclic compounds

Thiazolecarboxylic acid or derivatives - 2,4,5-trisubstituted 1,3-thiazole - Dicarboxylic acid or derivatives - Heteroaromatic compound - Organic disulfide - Carboxylic acid ester - Azacycle - Sulfenyl compound - Carboxylic acid derivative - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as thiazolecarboxylic acids and derivatives. These are heterocyclic compounds containing a thiazole ring which bears a carboxylic acid group (or a derivative thereof).

Not available