CC(C)C(=O)N\C=C(/N(C1=CC=CC=C1)C1=CC=CC=C1)C1=CC=CC=C1

InChIKey=VZPWITKLLPBJAV-NKFKGCMQSA-N

C24H24N2O

356.469

Organic compounds

Organic nitrogen compounds

Organonitrogen compounds

Amines

Tertiary amines

Tertiary alkylarylamines

Styrenes Aniline and substituted anilines Secondary carboxylic acid amides Amino acids and derivatives Enamines Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic homomonocyclic compounds

Styrene - Tertiary aliphatic/aromatic amine - Aniline or substituted anilines - Monocyclic benzene moiety - Benzenoid - Amino acid or derivatives - Carboxamide group - Secondary carboxylic acid amide - Enamine - Carboxylic acid derivative - Organooxygen compound - Carbonyl group - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Aromatic homomonocyclic compound

This compound belongs to the class of organic compounds known as tertiary alkylarylamines. These are tertiary amines where the nitrogen atom is linked to at least one alkyl group and at least one aryl group.

Not available