OC(=O)CN(CC(O)=O)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F

InChIKey=VXWYAIUHSGJZGP-UHFFFAOYSA-N

C12H6F17NO6S

615.21

Organic compounds

Organohalogen compounds

Alkyl halides

Alkyl fluorides

Perfluoroalkyl sulfonic acid and derivatives

Perfluorooctane sulfonic acid and derivatives

Alpha amino acids and derivatives Organosulfonamides Organic sulfonamides Dicarboxylic acids and derivatives Aminosulfonyl compounds Carboxylic acids Organonitrogen compounds Organofluorides Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aliphatic acyclic compounds

Perfluorooctane sulfonic acid or derivatives - Alpha-amino acid or derivatives - Dicarboxylic acid or derivatives - Organic sulfonic acid amide - Organosulfonic acid amide - Organic sulfonic acid or derivatives - Organosulfonic acid or derivatives - Sulfonyl - Aminosulfonyl compound - Carboxylic acid - Carboxylic acid derivative - Organic oxide - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Organofluoride - Organic oxygen compound - Organic nitrogen compound - Hydrocarbon derivative - Carbonyl group - Aliphatic acyclic compound

This compound belongs to the class of organic compounds known as perfluorooctane sulfonic acid and derivatives. These are organic compounds containing an octyl chain attached to the sulfur of a sulfonic acid (or a derivative thereof), where all hydrogens of the octyl chain are replaced by fluorine atoms.

Not available