CCO[C@H](C)SCC(=O)NCC(CCC(O)=O)NC(=O)CS[C@@H](C)OCC

InChIKey=VSNRNNHDFNBODE-RFHHWMCGSA-N

C17H32N2O6S2

424.57

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Amino acids, peptides, and analogues

Amino acids and derivatives

Gamma amino acids and derivatives

Fatty acids and conjugates Monothioacetals Secondary carboxylic acid amides Sulfenyl compounds Monocarboxylic acids and derivatives Carboxylic acids Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aliphatic acyclic compounds

Gamma amino acid or derivatives - Fatty acid - Monothioacetal - Secondary carboxylic acid amide - Carboxamide group - Sulfenyl compound - Monocarboxylic acid or derivatives - Carboxylic acid - Organic oxide - Hydrocarbon derivative - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Organic nitrogen compound - Carbonyl group - Organic oxygen compound - Aliphatic acyclic compound

This compound belongs to the class of organic compounds known as gamma amino acids and derivatives. These are amino acids having a (-NH2) group attached to the gamma carbon atom.

Not available