CCOC(=O)C1=C(NC(=O)NC)SC=N1

InChIKey=VOGROPQRNANKHH-UHFFFAOYSA-N

C8H11N3O3S

229.25

Organic compounds

Organoheterocyclic compounds

Azoles

Thiazoles

Not available

Thiazolecarboxylic acids and derivatives

4,5-disubstituted thiazoles Vinylogous amides Heteroaromatic compounds Ureas Carboxylic acid esters Monocarboxylic acids and derivatives Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic heteromonocyclic compounds

Thiazolecarboxylic acid or derivatives - 4,5-disubstituted 1,3-thiazole - Heteroaromatic compound - Vinylogous amide - Urea - Carbonic acid derivative - Carboxylic acid ester - Azacycle - Monocarboxylic acid or derivatives - Carboxylic acid derivative - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Carbonyl group - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as thiazolecarboxylic acids and derivatives. These are heterocyclic compounds containing a thiazole ring which bears a carboxylic acid group (or a derivative thereof).

Not available