CC1CCN2CCCCCCCCCCN(CCCOCCCCOCCC2)CCC(C)CN(C1)C(C)=O

InChIKey=VIIMZOMDQUNDTP-UHFFFAOYSA-N

C32H63N3O3

537.874

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Carboxylic acid derivatives

Carboxylic acid amides

Tertiary carboxylic acid amides

Acetamides Trialkylamines Amino acids and derivatives Oxacyclic compounds Dialkyl ethers Azacyclic compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aliphatic heteropolycyclic compounds

Tertiary carboxylic acid amide - Acetamide - Amino acid or derivatives - Tertiary amine - Tertiary aliphatic amine - Dialkyl ether - Ether - Organoheterocyclic compound - Oxacycle - Azacycle - Organic oxygen compound - Organooxygen compound - Organonitrogen compound - Amine - Organic oxide - Hydrocarbon derivative - Organic nitrogen compound - Carbonyl group - Aliphatic heteropolycyclic compound

This compound belongs to the class of organic compounds known as tertiary carboxylic acid amides. These are compounds containing an amide derivative of carboxylic acid, with the general structure RN(R1)C(R2)=O (R1-R2 any atom but H).

Not available