O[C@H](S)[C@@]1(NO1)C(O)=O

InChIKey=UXLWBOKCBIGNPO-PWNYCUMCSA-N

C3H5NO4S

151.14

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Amino acids, peptides, and analogues

Amino acids and derivatives

Alpha amino acids and derivatives

Beta hydroxy acids and derivatives Oxacyclic compounds N-organohydroxylamines Monocarboxylic acids and derivatives Carboxylic acids Azacyclic compounds Alkylthiols Organopnictogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aliphatic heteromonocyclic compounds

Alpha-amino acid or derivatives - Beta-hydroxy acid - Hydroxy acid - Alkylthiol - Carboxylic acid - Oxacycle - Azacycle - N-organohydroxylamine - Organoheterocyclic compound - Monocarboxylic acid or derivatives - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Organosulfur compound - Hydrocarbon derivative - Organic oxide - Carbonyl group - Organopnictogen compound - Organic oxygen compound - Aliphatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as alpha amino acids and derivatives. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon), or a derivative thereof.

Not available