CCOP(=S)(OCC)OC1=CN=C(N=C1)C(C)C

InChIKey=UXFIVEQQUWGMFC-UHFFFAOYSA-N

C11H19N2O3PS

290.32

Organic compounds

Organic acids and derivatives

Organic thiophosphoric acids and derivatives

Thiophosphoric acid esters

Aryl thiophosphates

Pyrimidinyl phosphorothioates

Thiophosphate triesters Pyrimidines and pyrimidine derivatives Heteroaromatic compounds Azacyclic compounds Organooxygen compounds Organonitrogen compounds Hydrocarbon derivatives

Aromatic heteromonocyclic compounds

Pyrimidinyl phosphorothioate - Thiophosphate triester - Pyrimidine - Heteroaromatic compound - Azacycle - Organoheterocyclic compound - Organic nitrogen compound - Organic oxygen compound - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as pyrimidinyl phosphorothioates. These are organic compounds containing the thiophosphoric acid functional group or a derivative thereof, with the general structure ROP(OR')(OR'')=S, where R= pyrimidine, R' = organyl group , and R\" = any atom.

Not available