COC(=O)CNC(=O)C(NC(=O)C1CC1)C1CCCCC1

InChIKey=UMLLQUKCADCONT-UHFFFAOYSA-N

C15H24N2O4

296.367

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Amino acids, peptides, and analogues

Not available

Peptides

N-acyl-alpha amino acids and derivatives Alpha amino acid esters Alpha amino acid amides Cyclopropanecarboxylic acids and derivatives Methyl esters Secondary carboxylic acid amides Monocarboxylic acids and derivatives Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aliphatic homomonocyclic compounds

Alpha peptide - Alpha-amino acid ester - N-acyl-alpha amino acid or derivatives - Alpha-amino acid amide - N-substituted-alpha-amino acid - Alpha-amino acid or derivatives - Cyclopropanecarboxylic acid or derivatives - Methyl ester - Secondary carboxylic acid amide - Carboxylic acid ester - Carboxamide group - Monocarboxylic acid or derivatives - Organonitrogen compound - Carbonyl group - Hydrocarbon derivative - Organic oxide - Organic oxygen compound - Organic nitrogen compound - Organooxygen compound - Aliphatic homomonocyclic compound

This compound belongs to the class of organic compounds known as peptides. These are compounds containing an amide derived from two or more amino carboxylic acid molecules (the same or different) by formation of a covalent bond from the carbonyl carbon of one to the nitrogen atom of another.

Not available