CCOC(=O)C1=C(NC(=O)C2CCCCC2)SC(=C1)C(C)C

InChIKey=ULLGQLFGBCBMKD-UHFFFAOYSA-N

C17H25NO3S

323.45

Organic compounds

Organoheterocyclic compounds

Thiophenes

Thiophene carboxylic acids and derivatives

Not available

Thiophene carboxylic acids and derivatives

N-arylamides 2,3,5-trisubstituted thiophenes Vinylogous amides Heteroaromatic compounds Secondary carboxylic acid amides Carboxylic acid esters Monocarboxylic acids and derivatives Organopnictogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic heteromonocyclic compounds

Thiophene carboxylic acid or derivatives - N-arylamide - 2,3,5-trisubstituted thiophene - Vinylogous amide - Heteroaromatic compound - Secondary carboxylic acid amide - Carboxylic acid ester - Carboxamide group - Monocarboxylic acid or derivatives - Carboxylic acid derivative - Carbonyl group - Organopnictogen compound - Organic oxygen compound - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Hydrocarbon derivative - Organic oxide - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as thiophene carboxylic acids and derivatives. These are compounds containing a thiophene ring which bears a carboxylic acid group (or a salt/ester thereof).

Not available