CC1CCOP(=O)(O1)N(C)C1=CC=CC=C1

InChIKey=UJUHYMZUCOHRJR-UHFFFAOYSA-N

C11H16NO3P

241.227

Organic compounds

Organic acids and derivatives

Organic phosphoric acids and derivatives

Phosphate esters

Not available

Phosphoric diester monoamides

Organic phosphoramides Benzene and substituted derivatives Oxacyclic compounds Organopnictogen compounds Organooxygen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives

Aromatic heteromonocyclic compounds

Phosphoric diester monoamide - Organic phosphoric acid amide - Benzenoid - Monocyclic benzene moiety - Oxacycle - Organoheterocyclic compound - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as phosphoric diester monoamides. These are organophosphorus compounds containing a monoamide derivative of a phosphoric acid diester functional group. They have the general structure R1OP(=O)(OR2)N(R3)R4, where R1-R2 = organyl group and R3-R4 = H or organyl.

Not available