FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=O)NCCC(C1=CC=CC=C1)C1=CC=CC=C1

InChIKey=UFTBNPBPEHKEFW-UHFFFAOYSA-N

C24H16F17NO

657.371

Organic compounds

Organohalogen compounds

Alkyl halides

Alkyl fluorides

Perfluoroalkyl carboxylic acid and derivatives

Perfluorooctanoic acid and derivatives

Diphenylmethanes N-acyl amines Secondary carboxylic acid amides Organonitrogen compounds Organofluorides Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic homomonocyclic compounds

Perfluorooctanoic acid or derivatives - Diphenylmethane - Monocyclic benzene moiety - Fatty amide - Fatty acyl - Benzenoid - N-acyl-amine - Carboxamide group - Secondary carboxylic acid amide - Carboxylic acid derivative - Organofluoride - Organooxygen compound - Hydrocarbon derivative - Organic oxide - Organic oxygen compound - Carbonyl group - Organic nitrogen compound - Organonitrogen compound - Aromatic homomonocyclic compound

This compound belongs to the class of organic compounds known as perfluorooctanoic acid and derivatives. These are organic compounds containing an octyl chain attached to the C-alpha of a carboxylic acid group (or a derivative thereof), where all hydrogens of the octyl chain are replaced by fluorine atoms.

Not available