O[C@@H]1C[C@@](O)(C=C([C@H]1O)C1=CN=CC=C1)C(O)=O

InChIKey=UENDUKMAYCPERY-FOGDFJRCSA-N

C12H13NO5

251.238

Organic compounds

Organic oxygen compounds

Organooxygen compounds

Alcohols and polyols

Cyclic alcohols and derivatives - Cyclitols and derivatives

Quinic acids and derivatives

Pyridines and derivatives Alpha hydroxy acids and derivatives Tertiary alcohols Heteroaromatic compounds Secondary alcohols Polyols Monocarboxylic acids and derivatives Carboxylic acids Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic heteromonocyclic compounds

Quinic acid - Alpha-hydroxy acid - Hydroxy acid - Pyridine - Heteroaromatic compound - Tertiary alcohol - Secondary alcohol - Azacycle - Organoheterocyclic compound - Polyol - Monocarboxylic acid or derivatives - Carboxylic acid - Carboxylic acid derivative - Organic nitrogen compound - Carbonyl group - Organonitrogen compound - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as quinic acids and derivatives. These are compounds containing a quinic acid moiety (or a derivative thereof), which is a cyclitol made up of a cyclohexane ring that bears four hydroxyl groups at positions 1,3.4, and 5, as well as a carboxylic acid at position 1.

Not available