CCCCCCC(=O)N(CC1CC1)CC(=O)NC1=NC(C)=C(C)S1

InChIKey=TYUMUBPZWRCQAC-UHFFFAOYSA-N

C18H29N3O2S

351.51

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Amino acids, peptides, and analogues

Amino acids and derivatives

Alpha amino acids and derivatives

N-arylamides 2,4,5-trisubstituted thiazoles N-acyl amines Tertiary carboxylic acid amides Heteroaromatic compounds Secondary carboxylic acid amides Azacyclic compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic heteromonocyclic compounds

Alpha-amino acid or derivatives - 2,4,5-trisubstituted 1,3-thiazole - N-arylamide - N-acyl-amine - Azole - Tertiary carboxylic acid amide - Thiazole - Heteroaromatic compound - Secondary carboxylic acid amide - Carboxamide group - Organoheterocyclic compound - Azacycle - Organic oxygen compound - Organooxygen compound - Organonitrogen compound - Organic oxide - Carbonyl group - Hydrocarbon derivative - Organic nitrogen compound - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as alpha amino acids and derivatives. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon), or a derivative thereof.

Not available