CC1=C(C=CO1)C(=O)NC1CCCCCC1

InChIKey=TWTRHBRADIAGHD-UHFFFAOYSA-N

C13H19NO2

221.3

Organic compounds

Organoheterocyclic compounds

Furans

Furoic acid and derivatives

Not available

Furan-3-carboxylic acid and derivatives

Heteroaromatic compounds Secondary carboxylic acid amides Oxacyclic compounds Organopnictogen compounds Organooxygen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives

Aromatic heteromonocyclic compounds

Furan-3-carboxylic acid or derivatives - Heteroaromatic compound - Secondary carboxylic acid amide - Carboxamide group - Oxacycle - Carboxylic acid derivative - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as furan-3-carboxylic acid and derivatives. These are aromatic heterocyclic compounds containing a furan ring, which carries a carboxyl group or a derivative thereof at the ring 3-position.

Not available