CCN1C(=S)SC(=CC=CN(C)C2=CC=CC=C2)C1=O

InChIKey=TUDYVCILAXJZPH-UHFFFAOYSA-N

C15H16N2OS2

304.43

Organic compounds

Organic nitrogen compounds

Organonitrogen compounds

Amines

Tertiary amines

Tertiary alkylarylamines

Aniline and substituted anilines Thiazolidinethiones Cyclic dithiocarbamic acid esters Amino acids and derivatives Enamines Azacyclic compounds Allylamines Organosulfur compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic heteromonocyclic compounds

Tertiary aliphatic/aromatic amine - Aniline or substituted anilines - Monocyclic benzene moiety - Thiazolidinethione - Benzenoid - Cyclic dithiocarbamic acid ester - Thiazolidine - Dithiocarbamic acid ester - Amino acid or derivatives - Carboxylic acid derivative - Enamine - Allylamine - Azacycle - Organoheterocyclic compound - Organooxygen compound - Organosulfur compound - Organic oxide - Hydrocarbon derivative - Carbonyl group - Organic oxygen compound - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as tertiary alkylarylamines. These are tertiary amines where the nitrogen atom is linked to at least one alkyl group and at least one aryl group.

Not available