CCN(CC)OC(=O)C1=CC=CC=C1O

InChIKey=SQCSJQKLUXDURR-UHFFFAOYSA-N

C11H15NO3

209.245

Organic compounds

Benzenoids

Benzene and substituted derivatives

Benzoic acids and derivatives

Hydroxybenzoic acid derivatives

Salicylic acid and derivatives

Benzoyl derivatives 1-hydroxy-4-unsubstituted benzenoids 1-hydroxy-2-unsubstituted benzenoids Vinylogous acids Carboxylic acids and derivatives Organooxygen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives

Aromatic homomonocyclic compounds

Salicylic acid or derivatives - Benzoyl - 1-hydroxy-4-unsubstituted benzenoid - 1-hydroxy-2-unsubstituted benzenoid - Phenol - Vinylogous acid - Carboxylic acid derivative - Organic nitrogen compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Aromatic homomonocyclic compound

This compound belongs to the class of organic compounds known as salicylic acid and derivatives. These are compounds containing a 2-hydroxybenzoic acid moiety or a derivative thereof.

Not available