CCC(=O)c1nc(NSc2cccs2)ccc1CC

InChIKey=SLPUSGGYQSBASV-UHFFFAOYSA-N

C14H16N2OS2

292.42

Organic compounds

Organic oxygen compounds

Organooxygen compounds

Carbonyl compounds

Ketones - Aryl ketones

Aryl alkyl ketones

Pyridines and derivatives Imidolactams Thiophenes Heteroaromatic compounds Sulfenyl compounds Organosulfenic acid amides Azacyclic compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives

Aromatic heteromonocyclic compounds

Aryl alkyl ketone - Imidolactam - Pyridine - Heteroaromatic compound - Thiophene - Azacycle - Organoheterocyclic compound - Sulfenyl compound - Organosulfenic acid amide - Organic nitrogen compound - Organic oxide - Hydrocarbon derivative - Organosulfur compound - Organonitrogen compound - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as aryl alkyl ketones. These are ketones have the generic structure RC(=O)R', where R = aryl group and R'=alkyl group.

Not available