CCC(C)CN(CC(=O)N(CC1=CC=C(C)S1)CC1=CC=CC=C1)C(=O)C1=CC=C(CC)C=C1

InChIKey=SKZWEGDKHBOMFY-UHFFFAOYSA-N

C29H36N2O2S

476.68

Organic compounds

Benzenoids

Benzene and substituted derivatives

Benzoic acids and derivatives

Benzamides

Hippuric acids and derivatives

Alpha amino acids and derivatives Benzoyl derivatives 2,5-disubstituted thiophenes Tertiary carboxylic acid amides Heteroaromatic compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic heteromonocyclic compounds

Hippuric acid or derivatives - Alpha-amino acid or derivatives - Benzoyl - 2,5-disubstituted thiophene - Tertiary carboxylic acid amide - Thiophene - Heteroaromatic compound - Carboxamide group - Carboxylic acid derivative - Organoheterocyclic compound - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Organic oxide - Carbonyl group - Hydrocarbon derivative - Organic oxygen compound - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as hippuric acids and derivatives. These are compounds containing a hippuric acid or a derivative, with a structure characterized the presence of a benzoyl group linked to the N-terminal of a glycine.

Not available