NC(=O)NCCC[C@H](NC(=O)C1=CC=CC=C1)C(N)=O

InChIKey=SKJZHESLTQXMNA-JTQLQIEISA-N

C13H18N4O3

278.312

Organic compounds

Benzenoids

Benzene and substituted derivatives

Benzoic acids and derivatives

Benzamides

Hippuric acids and derivatives

N-acyl-alpha amino acids and derivatives Benzoyl derivatives Fatty amides Ureas Secondary carboxylic acid amides Primary carboxylic acid amides Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic homomonocyclic compounds

Hippuric acid or derivatives - N-acyl-alpha amino acid or derivatives - N-substituted-alpha-amino acid - Alpha-amino acid or derivatives - Benzoyl - Fatty amide - Fatty acyl - Carboxamide group - Urea - Carbonic acid derivative - Primary carboxylic acid amide - Secondary carboxylic acid amide - Carboxylic acid derivative - Organic oxygen compound - Hydrocarbon derivative - Organic oxide - Organic nitrogen compound - Organonitrogen compound - Organooxygen compound - Organopnictogen compound - Carbonyl group - Aromatic homomonocyclic compound

This compound belongs to the class of organic compounds known as hippuric acids and derivatives. These are compounds containing a hippuric acid or a derivative, with a structure characterized the presence of a benzoyl group linked to the N-terminal of a glycine.

Not available