CCN(C[C@H]1CN[C@@H]1C)C(=O)C(F)(F)F

InChIKey=SGZDEEFEUPWOOF-RNFRBKRXSA-N

C9H15F3N2O

224.227

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Carboxylic acid derivatives

Carboxylic acid amides

Tertiary carboxylic acid amides

Azetidines Amino acids and derivatives Dialkylamines Azacyclic compounds Organofluorides Organic oxides Hydrocarbon derivatives Carbonyl compounds Alkyl fluorides

Aliphatic heteromonocyclic compounds

Tertiary carboxylic acid amide - Amino acid or derivatives - Azetidine - Secondary aliphatic amine - Secondary amine - Organoheterocyclic compound - Azacycle - Alkyl fluoride - Organooxygen compound - Organonitrogen compound - Organofluoride - Organohalogen compound - Carbonyl group - Organic oxygen compound - Organic nitrogen compound - Organic oxide - Alkyl halide - Amine - Hydrocarbon derivative - Aliphatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as tertiary carboxylic acid amides. These are compounds containing an amide derivative of carboxylic acid, with the general structure RN(R1)C(R2)=O (R1-R2 any atom but H).

Not available