CCOC1=CC(=CC(OCC)=C1OCC)C(=O)OCC(=O)NNC(=O)C1=CC=CS1

InChIKey=SCRCCJQDWCBXNW-UHFFFAOYSA-N

C20H24N2O7S

436.48

Organic compounds

Benzenoids

Benzene and substituted derivatives

Benzoic acids and derivatives

Hydroxybenzoic acid derivatives

Gallic acid and derivatives

Benzoic acid esters Thiophene carboxamides Phenoxy compounds Phenol ethers Benzoyl derivatives Alkyl aryl ethers Heteroaromatic compounds Carboxylic acid hydrazides Carboxylic acid esters Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic heteromonocyclic compounds

Gallic acid or derivatives - Benzoate ester - Phenoxy compound - Benzoyl - Thiophene carboxylic acid or derivatives - Thiophene carboxamide - Phenol ether - Alkyl aryl ether - Heteroaromatic compound - Thiophene - Carboxylic acid ester - Carboxylic acid hydrazide - Carboxylic acid derivative - Organoheterocyclic compound - Ether - Hydrocarbon derivative - Organic nitrogen compound - Carbonyl group - Organic oxide - Organic oxygen compound - Organooxygen compound - Organonitrogen compound - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as gallic acid and derivatives. These are compounds containing a 3,4,5-trihydroxybenzoic acid moiety.

Not available