C[C@H](CCC(O)=O)[C@H]1CC[C@H]2[C@@H]3CC[C@]4(O)C[C@H](O)CC[C@]4(C)[C@H]3CC[C@]12C

InChIKey=SBXYHNSBJFYMBV-WKFNKOIDSA-N

C24H40O4

392.58

Organic compounds

Lipids and lipid-like molecules

Steroids and steroid derivatives

Bile acids, alcohols and derivatives

Hydroxy bile acids, alcohols and derivatives

Dihydroxy bile acids, alcohols and derivatives

3-alpha-hydroxysteroids Tertiary alcohols Secondary alcohols Cyclic alcohols and derivatives Monocarboxylic acids and derivatives Carboxylic acids Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aliphatic homopolycyclic compounds

Dihydroxy bile acid, alcohol, or derivatives - 3-hydroxysteroid - 5-hydroxysteroid - 3-alpha-hydroxysteroid - Hydroxysteroid - Cyclic alcohol - Tertiary alcohol - Secondary alcohol - Monocarboxylic acid or derivatives - Carboxylic acid - Carboxylic acid derivative - Alcohol - Hydrocarbon derivative - Organic oxide - Organic oxygen compound - Carbonyl group - Organooxygen compound - Aliphatic homopolycyclic compound

This compound belongs to the class of organic compounds known as dihydroxy bile acids, alcohols and derivatives. These are compounds containing or derived from a bile acid or alcohol, and which bears exactly two carboxylic acid groups.

LIPIDMAPS (LMST04010412) : C24 bile acids, alcohols, and derivatives